C19H14F3NO4 — CID 44819890
ethyl 5-[3-[(2,3,6-trifluorophenyl)methoxy]phenyl]-1,2-oxazole-3-carboxylate (PubChem CID 44819890) has the molecular formula C19H14F3NO4 and a molecular weight of 377.32 g/mol. Its IUPAC name is ethyl 5-[3-[(2,3,6-trifluorophenyl)methoxy]phenyl]-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-[3-[(2,3,6-trifluorophenyl)methoxy]phenyl]-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 44819890 |
| Molecular Formula | C19H14F3NO4 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | ethyl 5-[3-[(2,3,6-trifluorophenyl)methoxy]phenyl]-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cccc(OCc3c(F)ccc(F)c3F)c2)on1 |
| InChI | InChI=1S/C19H14F3NO4/c1-2-25-19(24)16-9-17(27-23-16)11-4-3-5-12(8-11)26-10-13-14(20)6-7-15(21)18(13)22/h3-9H,2,10H2,1H3 |
| InChIKey | WNSXPWXQIFYVPH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|