About methyl 5-(4-ethoxycarbonylphenyl)-1,2-oxazole-3-carboxylate
methyl 5-(4-ethoxycarbonylphenyl)-1,2-oxazole-3-carboxylate (PubChem CID 86222844) has the molecular formula C14H13NO5
and a molecular weight of 275.26 g/mol. Its IUPAC name is methyl 5-(4-ethoxycarbonylphenyl)-1,2-oxazole-3-carboxylate.
Analyze methyl 5-(4-ethoxycarbonylphenyl)-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(4-ethoxycarbonylphenyl)-1,2-oxazole-3-carboxylate?
The IUPAC name of methyl 5-(4-ethoxycarbonylphenyl)-1,2-oxazole-3-carboxylate (CID 86222844) is methyl 5-(4-ethoxycarbonylphenyl)-1,2-oxazole-3-carboxylate.
What is the SMILES notation for methyl 5-(4-ethoxycarbonylphenyl)-1,2-oxazole-3-carboxylate?
The canonical SMILES for methyl 5-(4-ethoxycarbonylphenyl)-1,2-oxazole-3-carboxylate is CCOC(=O)c1ccc(-c2cc(C(=O)OC)no2)cc1.
What is the InChIKey of methyl 5-(4-ethoxycarbonylphenyl)-1,2-oxazole-3-carboxylate?
The InChIKey is RYGXJVLPSHCCCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO5/c1-3-19-13(16)10-6-4-9(5-7-10)12-8-11(15-20-12)14(17)18-2/h4-8H,3H2,1-2H3.
What are the key properties of methyl 5-(4-ethoxycarbonylphenyl)-1,2-oxazole-3-carboxylate?
methyl 5-(4-ethoxycarbonylphenyl)-1,2-oxazole-3-carboxylate has a molecular weight of 275.26 g/mol, XLogP of 2.30, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(4-ethoxycarbonylphenyl)-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 86222844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).