C13H13NO3 — CID 154791625
methyl 5-(3,5-dimethylphenyl)-1,2-oxazole-3-carboxylate (PubChem CID 154791625) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is methyl 5-(3,5-dimethylphenyl)-1,2-oxazole-3-carboxylate.
| Compound Name | methyl 5-(3,5-dimethylphenyl)-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 154791625 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | methyl 5-(3,5-dimethylphenyl)-1,2-oxazole-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2cc(C)cc(C)c2)on1 |
| InChI | InChI=1S/C13H13NO3/c1-8-4-9(2)6-10(5-8)12-7-11(14-17-12)13(15)16-3/h4-7H,1-3H3 |
| InChIKey | PSHHFKVHCCLXLY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |