C11H8N2O6 — CID 154791683
methyl 5-(4-hydroxy-3-nitrophenyl)-1,2-oxazole-3-carboxylate (PubChem CID 154791683) has the molecular formula C11H8N2O6 and a molecular weight of 264.19 g/mol. Its IUPAC name is methyl 5-(4-hydroxy-3-nitrophenyl)-1,2-oxazole-3-carboxylate.
| Compound Name | methyl 5-(4-hydroxy-3-nitrophenyl)-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 154791683 |
| Molecular Formula | C11H8N2O6 |
| Molecular Weight | 264.19 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | methyl 5-(4-hydroxy-3-nitrophenyl)-1,2-oxazole-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccc(O)c([N+](=O)[O-])c2)on1 |
| InChI | InChI=1S/C11H8N2O6/c1-18-11(15)7-5-10(19-12-7)6-2-3-9(14)8(4-6)13(16)17/h2-5,14H,1H3 |
| InChIKey | YLMHBGZFDXRVIK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 115.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.19 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|