C21H20N2O4 — CID 16878494
ethyl 4-[[2-[5-(4-methylphenyl)-1,2-oxazol-3-yl]acetyl]amino]benzoate (PubChem CID 16878494) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is ethyl 4-[[2-[5-(4-methylphenyl)-1,2-oxazol-3-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[5-(4-methylphenyl)-1,2-oxazol-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 16878494 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | ethyl 4-[[2-[5-(4-methylphenyl)-1,2-oxazol-3-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cc2cc(-c3ccc(C)cc3)on2)cc1 |
| InChI | InChI=1S/C21H20N2O4/c1-3-26-21(25)16-8-10-17(11-9-16)22-20(24)13-18-12-19(27-23-18)15-6-4-14(2)5-7-15/h4-12H,3,13H2,1-2H3,(H,22,24) |
| InChIKey | QCBZXEYIMKSDPN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |