C22H21NO6 — CID 159441639
methyl 4-acetylbenzoate;methyl 4-(3-methyl-1,2-oxazol-5-yl)benzoate (PubChem CID 159441639) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is methyl 4-acetylbenzoate;methyl 4-(3-methyl-1,2-oxazol-5-yl)benzoate.
| Compound Name | methyl 4-acetylbenzoate;methyl 4-(3-methyl-1,2-oxazol-5-yl)benzoate |
|---|---|
| PubChem CID | 159441639 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | methyl 4-acetylbenzoate;methyl 4-(3-methyl-1,2-oxazol-5-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2cc(C)no2)cc1.COC(=O)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C12H11NO3.C10H10O3/c1-8-7-11(16-13-8)9-3-5-10(6-4-9)12(14)15-2;1-7(11)8-3-5-9(6-4-8)10(12)13-2/h3-7H,1-2H3;3-6H,1-2H3 |
| InChIKey | LSGBGPWASKYXPB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 95.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |