C17H21NO5 — CID 174762997
tert-butyl formate;methyl 4-(3-methyl-1,2-oxazol-5-yl)benzoate (PubChem CID 174762997) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is tert-butyl formate;methyl 4-(3-methyl-1,2-oxazol-5-yl)benzoate.
| Compound Name | tert-butyl formate;methyl 4-(3-methyl-1,2-oxazol-5-yl)benzoate |
|---|---|
| PubChem CID | 174762997 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | tert-butyl formate;methyl 4-(3-methyl-1,2-oxazol-5-yl)benzoate |
| SMILES | CC(C)(C)OC=O.COC(=O)c1ccc(-c2cc(C)no2)cc1 |
| InChI | InChI=1S/C12H11NO3.C5H10O2/c1-8-7-11(16-13-8)9-3-5-10(6-4-9)12(14)15-2;1-5(2,3)7-4-6/h3-7H,1-2H3;4H,1-3H3 |
| InChIKey | GSFVXWDSFUYKFC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|