C15H17ClN2O2 — CID 46087261
N-butyl-5-(4-chlorophenyl)-N-methyl-1,2-oxazole-3-carboxamide (PubChem CID 46087261) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is N-butyl-5-(4-chlorophenyl)-N-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-butyl-5-(4-chlorophenyl)-N-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 46087261 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | N-butyl-5-(4-chlorophenyl)-N-methyl-1,2-oxazole-3-carboxamide |
| SMILES | CCCCN(C)C(=O)c1cc(-c2ccc(Cl)cc2)on1 |
| InChI | InChI=1S/C15H17ClN2O2/c1-3-4-9-18(2)15(19)13-10-14(20-17-13)11-5-7-12(16)8-6-11/h5-8,10H,3-4,9H2,1-2H3 |
| InChIKey | GXFVKFUREKENAT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |