C17H17NO2 — CID 122365402
1-benzo[e][1,3]benzoxazol-2-yl-3,3-dimethylbutan-2-one (PubChem CID 122365402) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 1-benzo[e][1,3]benzoxazol-2-yl-3,3-dimethylbutan-2-one.
| Compound Name | 1-benzo[e][1,3]benzoxazol-2-yl-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 122365402 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 1-benzo[e][1,3]benzoxazol-2-yl-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)Cc1nc2c(ccc3ccccc32)o1 |
| InChI | InChI=1S/C17H17NO2/c1-17(2,3)14(19)10-15-18-16-12-7-5-4-6-11(12)8-9-13(16)20-15/h4-9H,10H2,1-3H3 |
| InChIKey | SIPCLXQGDJQSKK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |