C19H14N2O — CID 127259737
N-[(E)-2-benzo[e][1,3]benzoxazol-2-ylethenyl]aniline (PubChem CID 127259737) has the molecular formula C19H14N2O and a molecular weight of 286.33 g/mol. Its IUPAC name is N-[(E)-2-benzo[e][1,3]benzoxazol-2-ylethenyl]aniline.
| Compound Name | N-[(E)-2-benzo[e][1,3]benzoxazol-2-ylethenyl]aniline |
|---|---|
| PubChem CID | 127259737 |
| Molecular Formula | C19H14N2O |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | N-[(E)-2-benzo[e][1,3]benzoxazol-2-ylethenyl]aniline |
| SMILES | C(=C/c1nc2c(ccc3ccccc32)o1)\Nc1ccccc1 |
| InChI | InChI=1S/C19H14N2O/c1-2-7-15(8-3-1)20-13-12-18-21-19-16-9-5-4-6-14(16)10-11-17(19)22-18/h1-13,20H/b13-12+ |
| InChIKey | OBFTUPUCVFDBSA-OUKQBFOZSA-N |
| XLogP | 5.06 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |