About N-[(E)-2-benzo[e][1,3]benzoxazol-2-ylethenyl]aniline
N-[(E)-2-benzo[e][1,3]benzoxazol-2-ylethenyl]aniline (PubChem CID 127259737) has the molecular formula C19H14N2O
and a molecular weight of 286.33 g/mol. Its IUPAC name is N-[(E)-2-benzo[e][1,3]benzoxazol-2-ylethenyl]aniline.
Molecular Properties
| Compound Name | N-[(E)-2-benzo[e][1,3]benzoxazol-2-ylethenyl]aniline |
| PubChem CID | 127259737 |
| Molecular Formula | C19H14N2O |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | N-[(E)-2-benzo[e][1,3]benzoxazol-2-ylethenyl]aniline |
| SMILES | C(=C/c1nc2c(ccc3ccccc32)o1)\Nc1ccccc1 |
| InChI | InChI=1S/C19H14N2O/c1-2-7-15(8-3-1)20-13-12-18-21-19-16-9-5-4-6-14(16)10-11-17(19)22-18/h1-13,20H/b13-12+ |
| InChIKey | OBFTUPUCVFDBSA-OUKQBFOZSA-N |
| XLogP | 5.06 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(E)-2-benzo[e][1,3]benzoxazol-2-ylethenyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-2-benzo[e][1,3]benzoxazol-2-ylethenyl]aniline?
The IUPAC name of N-[(E)-2-benzo[e][1,3]benzoxazol-2-ylethenyl]aniline (CID 127259737) is N-[(E)-2-benzo[e][1,3]benzoxazol-2-ylethenyl]aniline.
What is the SMILES notation for N-[(E)-2-benzo[e][1,3]benzoxazol-2-ylethenyl]aniline?
The canonical SMILES for N-[(E)-2-benzo[e][1,3]benzoxazol-2-ylethenyl]aniline is C(=C/c1nc2c(ccc3ccccc32)o1)\Nc1ccccc1.
What is the InChIKey of N-[(E)-2-benzo[e][1,3]benzoxazol-2-ylethenyl]aniline?
The InChIKey is OBFTUPUCVFDBSA-OUKQBFOZSA-N. The full InChI is InChI=1S/C19H14N2O/c1-2-7-15(8-3-1)20-13-12-18-21-19-16-9-5-4-6-14(16)10-11-17(19)22-18/h1-13,20H/b13-12+.
What are the key properties of N-[(E)-2-benzo[e][1,3]benzoxazol-2-ylethenyl]aniline?
N-[(E)-2-benzo[e][1,3]benzoxazol-2-ylethenyl]aniline has a molecular weight of 286.33 g/mol, XLogP of 5.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-2-benzo[e][1,3]benzoxazol-2-ylethenyl]aniline is sourced from PubChem (CID 127259737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).