C21H20ClN2O5+ — CID 126960827
N-[(E)-2-(1-ethylbenzo[e][1,3]benzoxazol-1-ium-2-yl)ethenyl]aniline;perchloric acid (PubChem CID 126960827) has the molecular formula C21H20ClN2O5+ and a molecular weight of 415.85 g/mol. Its IUPAC name is N-[(E)-2-(1-ethylbenzo[e][1,3]benzoxazol-1-ium-2-yl)ethenyl]aniline;perchloric acid.
| Compound Name | N-[(E)-2-(1-ethylbenzo[e][1,3]benzoxazol-1-ium-2-yl)ethenyl]aniline;perchloric acid |
|---|---|
| PubChem CID | 126960827 |
| Molecular Formula | C21H20ClN2O5+ |
| Molecular Weight | 415.85 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-[(E)-2-(1-ethylbenzo[e][1,3]benzoxazol-1-ium-2-yl)ethenyl]aniline;perchloric acid |
| SMILES | CC[n+]1c(/C=C/Nc2ccccc2)oc2ccc3ccccc3c21.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C21H18N2O.ClHO4/c1-2-23-20(14-15-22-17-9-4-3-5-10-17)24-19-13-12-16-8-6-7-11-18(16)21(19)23;2-1(3,4)5/h3-15H,2H2,1H3;(H,2,3,4,5)/p+1 |
| InChIKey | CLKBUDFPPZJMHT-UHFFFAOYSA-O |
| XLogP | 0.85 |
| TPSA | 118.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.85 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|