C18H19IN2O2 — CID 91733250
N-[(E)-2-(3-ethyl-5-methoxy-1,3-benzoxazol-3-ium-2-yl)ethenyl]aniline iodide (PubChem CID 91733250) has the molecular formula C18H19IN2O2 and a molecular weight of 422.27 g/mol. Its IUPAC name is N-[(E)-2-(3-ethyl-5-methoxy-1,3-benzoxazol-3-ium-2-yl)ethenyl]aniline iodide.
| Compound Name | N-[(E)-2-(3-ethyl-5-methoxy-1,3-benzoxazol-3-ium-2-yl)ethenyl]aniline iodide |
|---|---|
| PubChem CID | 91733250 |
| Molecular Formula | C18H19IN2O2 |
| Molecular Weight | 422.27 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | N-[(E)-2-(3-ethyl-5-methoxy-1,3-benzoxazol-3-ium-2-yl)ethenyl]aniline iodide |
| SMILES | CC[n+]1c(/C=C/Nc2ccccc2)oc2ccc(OC)cc21.[I-] |
| InChI | InChI=1S/C18H18N2O2.HI/c1-3-20-16-13-15(21-2)9-10-17(16)22-18(20)11-12-19-14-7-5-4-6-8-14;/h4-13H,3H2,1-2H3;1H |
| InChIKey | OELWKRIPUUMEHJ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 38.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|