C15H20NO3+ — CID 762818
2-[(Z)-2-ethoxybut-1-enyl]-5-methoxy-3-methyl-1,3-benzoxazol-3-ium (PubChem CID 762818) has the molecular formula C15H20NO3+ and a molecular weight of 262.33 g/mol. Its IUPAC name is 2-[(Z)-2-ethoxybut-1-enyl]-5-methoxy-3-methyl-1,3-benzoxazol-3-ium.
| Compound Name | 2-[(Z)-2-ethoxybut-1-enyl]-5-methoxy-3-methyl-1,3-benzoxazol-3-ium |
|---|---|
| PubChem CID | 762818 |
| Molecular Formula | C15H20NO3+ |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-[(Z)-2-ethoxybut-1-enyl]-5-methoxy-3-methyl-1,3-benzoxazol-3-ium |
| SMILES | CCO/C(=C\c1oc2ccc(OC)cc2[n+]1C)CC |
| InChI | InChI=1S/C15H20NO3/c1-5-11(18-6-2)10-15-16(3)13-9-12(17-4)7-8-14(13)19-15/h7-10H,5-6H2,1-4H3/q+1/b11-10- |
| InChIKey | LBGSPMIATZQJTK-KHPPLWFESA-N |
| XLogP | 3.05 |
| TPSA | 35.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|