C15H20BrNO2S — CID 44658078
2-[(E)-2-ethoxyprop-1-enyl]-3-ethyl-5-methoxy-1,3-benzothiazol-3-ium bromide (PubChem CID 44658078) has the molecular formula C15H20BrNO2S and a molecular weight of 358.30 g/mol. Its IUPAC name is 2-[(E)-2-ethoxyprop-1-enyl]-3-ethyl-5-methoxy-1,3-benzothiazol-3-ium bromide.
| Compound Name | 2-[(E)-2-ethoxyprop-1-enyl]-3-ethyl-5-methoxy-1,3-benzothiazol-3-ium bromide |
|---|---|
| PubChem CID | 44658078 |
| Molecular Formula | C15H20BrNO2S |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 2-[(E)-2-ethoxyprop-1-enyl]-3-ethyl-5-methoxy-1,3-benzothiazol-3-ium bromide |
| SMILES | CCO/C(C)=C/c1sc2ccc(OC)cc2[n+]1CC.[Br-] |
| InChI | InChI=1S/C15H20NO2S.BrH/c1-5-16-13-10-12(17-4)7-8-14(13)19-15(16)9-11(3)18-6-2;/h7-10H,5-6H2,1-4H3;1H/q+1;/p-1/b11-9+; |
| InChIKey | YXMVBEHRMKLRQN-LBEJWNQZSA-M |
| XLogP | 0.62 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|