C18H22NO4S2+ — CID 6610596
3-ethyl-5-methoxy-2-methyl-1,3-benzothiazol-3-ium;4-methylbenzenesulfonic acid (PubChem CID 6610596) has the molecular formula C18H22NO4S2+ and a molecular weight of 380.51 g/mol. Its IUPAC name is 3-ethyl-5-methoxy-2-methyl-1,3-benzothiazol-3-ium;4-methylbenzenesulfonic acid.
| Compound Name | 3-ethyl-5-methoxy-2-methyl-1,3-benzothiazol-3-ium;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 6610596 |
| Molecular Formula | C18H22NO4S2+ |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 3-ethyl-5-methoxy-2-methyl-1,3-benzothiazol-3-ium;4-methylbenzenesulfonic acid |
| SMILES | CC[n+]1c(C)sc2ccc(OC)cc21.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C11H14NOS.C7H8O3S/c1-4-12-8(2)14-11-6-5-9(13-3)7-10(11)12;1-6-2-4-7(5-3-6)11(8,9)10/h5-7H,4H2,1-3H3;2-5H,1H3,(H,8,9,10)/q+1; |
| InChIKey | RAPZVIBWDBUCCW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|