C15H16NO6S3+ — CID 123860430
3-ethyl-5-methoxysulfonyl-2-methylbenzo[g][1,3]benzothiazol-3-ium-7-sulfonic acid (PubChem CID 123860430) has the molecular formula C15H16NO6S3+ and a molecular weight of 402.50 g/mol. Its IUPAC name is 3-ethyl-5-methoxysulfonyl-2-methylbenzo[g][1,3]benzothiazol-3-ium-7-sulfonic acid.
| Compound Name | 3-ethyl-5-methoxysulfonyl-2-methylbenzo[g][1,3]benzothiazol-3-ium-7-sulfonic acid |
|---|---|
| PubChem CID | 123860430 |
| Molecular Formula | C15H16NO6S3+ |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 3-ethyl-5-methoxysulfonyl-2-methylbenzo[g][1,3]benzothiazol-3-ium-7-sulfonic acid |
| SMILES | CC[n+]1c(C)sc2c3ccc(S(=O)(=O)O)cc3c(S(=O)(=O)OC)cc21 |
| InChI | InChI=1S/C15H15NO6S3/c1-4-16-9(2)23-15-11-6-5-10(24(17,18)19)7-12(11)14(8-13(15)16)25(20,21)22-3/h5-8H,4H2,1-3H3/p+1 |
| InChIKey | LMKGRDWQFAURIK-UHFFFAOYSA-O |
| XLogP | 2.25 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|