C19H19NaO7S — CID 173275533
sodium;7-ethoxycarbonyl-9,10-dimethoxyanthracene-2-sulfonic acid;hydride (PubChem CID 173275533) has the molecular formula C19H19NaO7S and a molecular weight of 414.41 g/mol. Its IUPAC name is sodium;7-ethoxycarbonyl-9,10-dimethoxyanthracene-2-sulfonic acid;hydride.
| Compound Name | sodium;7-ethoxycarbonyl-9,10-dimethoxyanthracene-2-sulfonic acid;hydride |
|---|---|
| PubChem CID | 173275533 |
| Molecular Formula | C19H19NaO7S |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | sodium;7-ethoxycarbonyl-9,10-dimethoxyanthracene-2-sulfonic acid;hydride |
| SMILES | CCOC(=O)c1ccc2c(OC)c3ccc(S(=O)(=O)O)cc3c(OC)c2c1.[H-].[Na+] |
| InChI | InChI=1S/C19H18O7S.Na.H/c1-4-26-19(20)11-5-7-13-15(9-11)18(25-3)16-10-12(27(21,22)23)6-8-14(16)17(13)24-2;;/h5-10H,4H2,1-3H3,(H,21,22,23);;/q;+1;-1 |
| InChIKey | GIPNFFDPRHDIAB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|