C10H11NaO7S — CID 175079130
sodium;2-ethoxycarbonyl-5-sulfobenzoic acid;hydride (PubChem CID 175079130) has the molecular formula C10H11NaO7S and a molecular weight of 298.25 g/mol. Its IUPAC name is sodium;2-ethoxycarbonyl-5-sulfobenzoic acid;hydride.
| Compound Name | sodium;2-ethoxycarbonyl-5-sulfobenzoic acid;hydride |
|---|---|
| PubChem CID | 175079130 |
| Molecular Formula | C10H11NaO7S |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | sodium;2-ethoxycarbonyl-5-sulfobenzoic acid;hydride |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)O)cc1C(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C10H10O7S.Na.H/c1-2-17-10(13)7-4-3-6(18(14,15)16)5-8(7)9(11)12;;/h3-5H,2H2,1H3,(H,11,12)(H,14,15,16);;/q;+1;-1 |
| InChIKey | JPFONYASZXUYPF-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|