C12H14NO3S+ — CID 793048
3-(5-methoxy-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid (PubChem CID 793048) has the molecular formula C12H14NO3S+ and a molecular weight of 252.31 g/mol. Its IUPAC name is 3-(5-methoxy-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid.
| Compound Name | 3-(5-methoxy-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid |
|---|---|
| PubChem CID | 793048 |
| Molecular Formula | C12H14NO3S+ |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 3-(5-methoxy-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid |
| SMILES | COc1ccc2sc(C)[n+](CCC(=O)O)c2c1 |
| InChI | InChI=1S/C12H13NO3S/c1-8-13(6-5-12(14)15)10-7-9(16-2)3-4-11(10)17-8/h3-4,7H,5-6H2,1-2H3/p+1 |
| InChIKey | MFCKADSULAZYFQ-UHFFFAOYSA-O |
| XLogP | 1.98 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|