C12H14NO2S+ — CID 54146344
3-(2,6-dimethyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid (PubChem CID 54146344) has the molecular formula C12H14NO2S+ and a molecular weight of 236.32 g/mol. Its IUPAC name is 3-(2,6-dimethyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid.
| Compound Name | 3-(2,6-dimethyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid |
|---|---|
| PubChem CID | 54146344 |
| Molecular Formula | C12H14NO2S+ |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 3-(2,6-dimethyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid |
| SMILES | Cc1ccc2c(c1)sc(C)[n+]2CCC(=O)O |
| InChI | InChI=1S/C12H13NO2S/c1-8-3-4-10-11(7-8)16-9(2)13(10)6-5-12(14)15/h3-4,7H,5-6H2,1-2H3/p+1 |
| InChIKey | OEQMXLBOLCHKBL-UHFFFAOYSA-O |
| XLogP | 2.28 |
| TPSA | 41.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|