3-(2,6-dimethyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid

C12H14NO2S+ — CID 54146344

IUPAC3-(2,6-dimethyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid
SMILESCc1ccc2c(c1)sc(C)[n+]2CCC(=O)O
InChIInChI=1S/C12H13NO2S/c1-8-3-4-10-11(7-8)16-9(2)13(10)6-5-12(14)15/h3-4,7H,5-6H2,1-2H3/p+1
InChIKeyOEQMXLBOLCHKBL-UHFFFAOYSA-O
MW236.32 g/mol
LogP2.28
Rot. Bonds3

About 3-(2,6-dimethyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid

3-(2,6-dimethyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid (PubChem CID 54146344) has the molecular formula C12H14NO2S+ and a molecular weight of 236.32 g/mol. Its IUPAC name is 3-(2,6-dimethyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid.

Molecular Properties

Compound Name3-(2,6-dimethyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid
PubChem CID54146344
Molecular FormulaC12H14NO2S+
Molecular Weight236.32 g/mol
Exact Mass236.07
IUPAC Name3-(2,6-dimethyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid
SMILESCc1ccc2c(c1)sc(C)[n+]2CCC(=O)O
InChIInChI=1S/C12H13NO2S/c1-8-3-4-10-11(7-8)16-9(2)13(10)6-5-12(14)15/h3-4,7H,5-6H2,1-2H3/p+1
InChIKeyOEQMXLBOLCHKBL-UHFFFAOYSA-O
XLogP2.28
TPSA41.18 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.32
LogP ≤ 52.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze 3-(2,6-dimethyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,6-dimethyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid?
The IUPAC name of 3-(2,6-dimethyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid (CID 54146344) is 3-(2,6-dimethyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid.
What is the SMILES notation for 3-(2,6-dimethyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid?
The canonical SMILES for 3-(2,6-dimethyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid is Cc1ccc2c(c1)sc(C)[n+]2CCC(=O)O.
What is the InChIKey of 3-(2,6-dimethyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid?
The InChIKey is OEQMXLBOLCHKBL-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H13NO2S/c1-8-3-4-10-11(7-8)16-9(2)13(10)6-5-12(14)15/h3-4,7H,5-6H2,1-2H3/p+1.
What are the key properties of 3-(2,6-dimethyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid?
3-(2,6-dimethyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid has a molecular weight of 236.32 g/mol, XLogP of 2.28, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dimethyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid is sourced from PubChem (CID 54146344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).