About 3-[2-(4-ethoxy-3-methylbuta-1,3-dienyl)-6-methyl-1,3-benzothiazol-3-ium-3-yl]propanoic acid
3-[2-(4-ethoxy-3-methylbuta-1,3-dienyl)-6-methyl-1,3-benzothiazol-3-ium-3-yl]propanoic acid (PubChem CID 54219340) has the molecular formula C18H22NO3S+
and a molecular weight of 332.45 g/mol. Its IUPAC name is 3-[2-(4-ethoxy-3-methylbuta-1,3-dienyl)-6-methyl-1,3-benzothiazol-3-ium-3-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[2-(4-ethoxy-3-methylbuta-1,3-dienyl)-6-methyl-1,3-benzothiazol-3-ium-3-yl]propanoic acid |
| PubChem CID | 54219340 |
| Molecular Formula | C18H22NO3S+ |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 3-[2-(4-ethoxy-3-methylbuta-1,3-dienyl)-6-methyl-1,3-benzothiazol-3-ium-3-yl]propanoic acid |
| SMILES | CCOC=C(C)C=Cc1sc2cc(C)ccc2[n+]1CCC(=O)O |
| InChI | InChI=1S/C18H21NO3S/c1-4-22-12-14(3)6-8-17-19(10-9-18(20)21)15-7-5-13(2)11-16(15)23-17/h5-8,11-12H,4,9-10H2,1-3H3/p+1 |
| InChIKey | QBLDKINLWQGXHL-UHFFFAOYSA-O |
| XLogP | 3.93 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(4-ethoxy-3-methylbuta-1,3-dienyl)-6-methyl-1,3-benzothiazol-3-ium-3-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(4-ethoxy-3-methylbuta-1,3-dienyl)-6-methyl-1,3-benzothiazol-3-ium-3-yl]propanoic acid?
The IUPAC name of 3-[2-(4-ethoxy-3-methylbuta-1,3-dienyl)-6-methyl-1,3-benzothiazol-3-ium-3-yl]propanoic acid (CID 54219340) is 3-[2-(4-ethoxy-3-methylbuta-1,3-dienyl)-6-methyl-1,3-benzothiazol-3-ium-3-yl]propanoic acid.
What is the SMILES notation for 3-[2-(4-ethoxy-3-methylbuta-1,3-dienyl)-6-methyl-1,3-benzothiazol-3-ium-3-yl]propanoic acid?
The canonical SMILES for 3-[2-(4-ethoxy-3-methylbuta-1,3-dienyl)-6-methyl-1,3-benzothiazol-3-ium-3-yl]propanoic acid is CCOC=C(C)C=Cc1sc2cc(C)ccc2[n+]1CCC(=O)O.
What is the InChIKey of 3-[2-(4-ethoxy-3-methylbuta-1,3-dienyl)-6-methyl-1,3-benzothiazol-3-ium-3-yl]propanoic acid?
The InChIKey is QBLDKINLWQGXHL-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H21NO3S/c1-4-22-12-14(3)6-8-17-19(10-9-18(20)21)15-7-5-13(2)11-16(15)23-17/h5-8,11-12H,4,9-10H2,1-3H3/p+1.
What are the key properties of 3-[2-(4-ethoxy-3-methylbuta-1,3-dienyl)-6-methyl-1,3-benzothiazol-3-ium-3-yl]propanoic acid?
3-[2-(4-ethoxy-3-methylbuta-1,3-dienyl)-6-methyl-1,3-benzothiazol-3-ium-3-yl]propanoic acid has a molecular weight of 332.45 g/mol, XLogP of 3.93, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(4-ethoxy-3-methylbuta-1,3-dienyl)-6-methyl-1,3-benzothiazol-3-ium-3-yl]propanoic acid is sourced from PubChem (CID 54219340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).