C18H22NO3S+ — CID 54219340
3-[2-(4-ethoxy-3-methylbuta-1,3-dienyl)-6-methyl-1,3-benzothiazol-3-ium-3-yl]propanoic acid (PubChem CID 54219340) has the molecular formula C18H22NO3S+ and a molecular weight of 332.45 g/mol. Its IUPAC name is 3-[2-(4-ethoxy-3-methylbuta-1,3-dienyl)-6-methyl-1,3-benzothiazol-3-ium-3-yl]propanoic acid.
| Compound Name | 3-[2-(4-ethoxy-3-methylbuta-1,3-dienyl)-6-methyl-1,3-benzothiazol-3-ium-3-yl]propanoic acid |
|---|---|
| PubChem CID | 54219340 |
| Molecular Formula | C18H22NO3S+ |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 3-[2-(4-ethoxy-3-methylbuta-1,3-dienyl)-6-methyl-1,3-benzothiazol-3-ium-3-yl]propanoic acid |
| SMILES | CCOC=C(C)C=Cc1sc2cc(C)ccc2[n+]1CCC(=O)O |
| InChI | InChI=1S/C18H21NO3S/c1-4-22-12-14(3)6-8-17-19(10-9-18(20)21)15-7-5-13(2)11-16(15)23-17/h5-8,11-12H,4,9-10H2,1-3H3/p+1 |
| InChIKey | QBLDKINLWQGXHL-UHFFFAOYSA-O |
| XLogP | 3.93 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|