C20H23N2S+ — CID 158747918
N-[1-(3-ethyl-6-methyl-1,3-benzothiazol-3-ium-2-yl)but-1-en-2-yl]aniline (PubChem CID 158747918) has the molecular formula C20H23N2S+ and a molecular weight of 323.49 g/mol. Its IUPAC name is N-[1-(3-ethyl-6-methyl-1,3-benzothiazol-3-ium-2-yl)but-1-en-2-yl]aniline.
| Compound Name | N-[1-(3-ethyl-6-methyl-1,3-benzothiazol-3-ium-2-yl)but-1-en-2-yl]aniline |
|---|---|
| PubChem CID | 158747918 |
| Molecular Formula | C20H23N2S+ |
| Molecular Weight | 323.49 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-[1-(3-ethyl-6-methyl-1,3-benzothiazol-3-ium-2-yl)but-1-en-2-yl]aniline |
| SMILES | CCC(=Cc1sc2cc(C)ccc2[n+]1CC)Nc1ccccc1 |
| InChI | InChI=1S/C20H22N2S/c1-4-16(21-17-9-7-6-8-10-17)14-20-22(5-2)18-12-11-15(3)13-19(18)23-20/h6-14H,4-5H2,1-3H3/p+1 |
| InChIKey | LTKQTWPMFXMYML-UHFFFAOYSA-O |
| XLogP | 5.38 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|