C10H13N2OS+ — CID 140958351
2-(2-amino-6-methyl-1,3-benzothiazol-3-ium-3-yl)ethanol (PubChem CID 140958351) has the molecular formula C10H13N2OS+ and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-(2-amino-6-methyl-1,3-benzothiazol-3-ium-3-yl)ethanol.
| Compound Name | 2-(2-amino-6-methyl-1,3-benzothiazol-3-ium-3-yl)ethanol |
|---|---|
| PubChem CID | 140958351 |
| Molecular Formula | C10H13N2OS+ |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-(2-amino-6-methyl-1,3-benzothiazol-3-ium-3-yl)ethanol |
| SMILES | Cc1ccc2c(c1)sc(N)[n+]2CCO |
| InChI | InChI=1S/C10H12N2OS/c1-7-2-3-8-9(6-7)14-10(11)12(8)4-5-13/h2-3,6,11,13H,4-5H2,1H3/p+1 |
| InChIKey | ZYEGBHHNJNZJHT-UHFFFAOYSA-O |
| XLogP | 1.07 |
| TPSA | 50.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|