C12H15N2O3S+ — CID 15666157
ethyl 2-(2-amino-6-methoxy-1,3-benzothiazol-3-ium-3-yl)acetate (PubChem CID 15666157) has the molecular formula C12H15N2O3S+ and a molecular weight of 267.33 g/mol. Its IUPAC name is ethyl 2-(2-amino-6-methoxy-1,3-benzothiazol-3-ium-3-yl)acetate.
| Compound Name | ethyl 2-(2-amino-6-methoxy-1,3-benzothiazol-3-ium-3-yl)acetate |
|---|---|
| PubChem CID | 15666157 |
| Molecular Formula | C12H15N2O3S+ |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | ethyl 2-(2-amino-6-methoxy-1,3-benzothiazol-3-ium-3-yl)acetate |
| SMILES | CCOC(=O)C[n+]1c(N)sc2cc(OC)ccc21 |
| InChI | InChI=1S/C12H14N2O3S/c1-3-17-11(15)7-14-9-5-4-8(16-2)6-10(9)18-12(14)13/h4-6,13H,3,7H2,1-2H3/p+1 |
| InChIKey | FORIWHGBYKIPBT-UHFFFAOYSA-O |
| XLogP | 1.34 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|