C17H15N4O2S+ — CID 2428584
2-(2-amino-6-methoxy-1,3-benzothiazol-3-ium-3-yl)-N-(3-cyanophenyl)acetamide (PubChem CID 2428584) has the molecular formula C17H15N4O2S+ and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-(2-amino-6-methoxy-1,3-benzothiazol-3-ium-3-yl)-N-(3-cyanophenyl)acetamide.
| Compound Name | 2-(2-amino-6-methoxy-1,3-benzothiazol-3-ium-3-yl)-N-(3-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 2428584 |
| Molecular Formula | C17H15N4O2S+ |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-(2-amino-6-methoxy-1,3-benzothiazol-3-ium-3-yl)-N-(3-cyanophenyl)acetamide |
| SMILES | COc1ccc2c(c1)sc(N)[n+]2CC(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C17H14N4O2S/c1-23-13-5-6-14-15(8-13)24-17(19)21(14)10-16(22)20-12-4-2-3-11(7-12)9-18/h2-8,19H,10H2,1H3,(H,20,22)/p+1 |
| InChIKey | NOUSSDMBJUTAMY-UHFFFAOYSA-O |
| XLogP | 2.29 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|