C17H17N3O4S — CID 113155193
N-(3-cyanophenyl)-2-(3-methoxy-N-methylsulfonylanilino)acetamide (PubChem CID 113155193) has the molecular formula C17H17N3O4S and a molecular weight of 359.41 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-(3-methoxy-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(3-cyanophenyl)-2-(3-methoxy-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 113155193 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-(3-cyanophenyl)-2-(3-methoxy-N-methylsulfonylanilino)acetamide |
| SMILES | COc1cccc(N(CC(=O)Nc2cccc(C#N)c2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C17H17N3O4S/c1-24-16-8-4-7-15(10-16)20(25(2,22)23)12-17(21)19-14-6-3-5-13(9-14)11-18/h3-10H,12H2,1-2H3,(H,19,21) |
| InChIKey | GPRUEAKSDCJJOV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |