C16H13Cl2N3O3S — CID 113156973
N-(3-cyanophenyl)-2-(2,6-dichloro-N-methylsulfonylanilino)acetamide (PubChem CID 113156973) has the molecular formula C16H13Cl2N3O3S and a molecular weight of 398.27 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-(2,6-dichloro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(3-cyanophenyl)-2-(2,6-dichloro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 113156973 |
| Molecular Formula | C16H13Cl2N3O3S |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | N-(3-cyanophenyl)-2-(2,6-dichloro-N-methylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1cccc(C#N)c1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H13Cl2N3O3S/c1-25(23,24)21(16-13(17)6-3-7-14(16)18)10-15(22)20-12-5-2-4-11(8-12)9-19/h2-8H,10H2,1H3,(H,20,22) |
| InChIKey | ABXZJSXITPTNDH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |