C10H10F3N2OS+ — CID 10661835
3-ethyl-6-(trifluoromethoxy)-1,3-benzothiazol-3-ium-2-amine (PubChem CID 10661835) has the molecular formula C10H10F3N2OS+ and a molecular weight of 263.26 g/mol. Its IUPAC name is 3-ethyl-6-(trifluoromethoxy)-1,3-benzothiazol-3-ium-2-amine.
| Compound Name | 3-ethyl-6-(trifluoromethoxy)-1,3-benzothiazol-3-ium-2-amine |
|---|---|
| PubChem CID | 10661835 |
| Molecular Formula | C10H10F3N2OS+ |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 3-ethyl-6-(trifluoromethoxy)-1,3-benzothiazol-3-ium-2-amine |
| SMILES | CC[n+]1c(N)sc2cc(OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C10H9F3N2OS/c1-2-15-7-4-3-6(16-10(11,12)13)5-8(7)17-9(15)14/h3-5,14H,2H2,1H3/p+1 |
| InChIKey | NKYBQBAWYVRYCZ-UHFFFAOYSA-O |
| XLogP | 2.69 |
| TPSA | 39.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|