C13H15N2O4S+ — CID 52904047
ethyl 2-amino-3-(2-methoxy-2-oxoethyl)-1,3-benzothiazol-3-ium-6-carboxylate (PubChem CID 52904047) has the molecular formula C13H15N2O4S+ and a molecular weight of 295.34 g/mol. Its IUPAC name is ethyl 2-amino-3-(2-methoxy-2-oxoethyl)-1,3-benzothiazol-3-ium-6-carboxylate.
| Compound Name | ethyl 2-amino-3-(2-methoxy-2-oxoethyl)-1,3-benzothiazol-3-ium-6-carboxylate |
|---|---|
| PubChem CID | 52904047 |
| Molecular Formula | C13H15N2O4S+ |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | ethyl 2-amino-3-(2-methoxy-2-oxoethyl)-1,3-benzothiazol-3-ium-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)sc(N)[n+]2CC(=O)OC |
| InChI | InChI=1S/C13H14N2O4S/c1-3-19-12(17)8-4-5-9-10(6-8)20-13(14)15(9)7-11(16)18-2/h4-6,14H,3,7H2,1-2H3/p+1 |
| InChIKey | QCDDYTNSJILGGD-UHFFFAOYSA-O |
| XLogP | 1.12 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|