C12H13N2O4S+ — CID 52904057
ethyl 2-(6-amino-[1,3]dioxolo[4,5-f][1,3]benzothiazol-7-ium-7-yl)acetate (PubChem CID 52904057) has the molecular formula C12H13N2O4S+ and a molecular weight of 281.31 g/mol. Its IUPAC name is ethyl 2-(6-amino-[1,3]dioxolo[4,5-f][1,3]benzothiazol-7-ium-7-yl)acetate.
| Compound Name | ethyl 2-(6-amino-[1,3]dioxolo[4,5-f][1,3]benzothiazol-7-ium-7-yl)acetate |
|---|---|
| PubChem CID | 52904057 |
| Molecular Formula | C12H13N2O4S+ |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | ethyl 2-(6-amino-[1,3]dioxolo[4,5-f][1,3]benzothiazol-7-ium-7-yl)acetate |
| SMILES | CCOC(=O)C[n+]1c(N)sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C12H12N2O4S/c1-2-16-11(15)5-14-7-3-8-9(18-6-17-8)4-10(7)19-12(14)13/h3-4,13H,2,5-6H2,1H3/p+1 |
| InChIKey | YVXIFNJZLUXSHW-UHFFFAOYSA-O |
| XLogP | 1.06 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|