C13H12F3IN2OS — CID 10387831
N,3-dimethyl-N-prop-2-ynyl-6-(trifluoromethoxy)-1,3-benzothiazol-3-ium-2-amine iodide (PubChem CID 10387831) has the molecular formula C13H12F3IN2OS and a molecular weight of 428.22 g/mol. Its IUPAC name is N,3-dimethyl-N-prop-2-ynyl-6-(trifluoromethoxy)-1,3-benzothiazol-3-ium-2-amine iodide.
| Compound Name | N,3-dimethyl-N-prop-2-ynyl-6-(trifluoromethoxy)-1,3-benzothiazol-3-ium-2-amine iodide |
|---|---|
| PubChem CID | 10387831 |
| Molecular Formula | C13H12F3IN2OS |
| Molecular Weight | 428.22 g/mol |
| Exact Mass | 427.97 |
| IUPAC Name | N,3-dimethyl-N-prop-2-ynyl-6-(trifluoromethoxy)-1,3-benzothiazol-3-ium-2-amine iodide |
| SMILES | C#CCN(C)c1sc2cc(OC(F)(F)F)ccc2[n+]1C.[I-] |
| InChI | InChI=1S/C13H12F3N2OS.HI/c1-4-7-17(2)12-18(3)10-6-5-9(8-11(10)20-12)19-13(14,15)16;/h1,5-6,8H,7H2,2-3H3;1H/q+1;/p-1 |
| InChIKey | XFTZDLQXANPLPY-UHFFFAOYSA-M |
| XLogP | -0.30 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.22 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|