C13H15F3N2OS2 — CID 14836835
3-(2-ethylsulfanylethyl)-N-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine (PubChem CID 14836835) has the molecular formula C13H15F3N2OS2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 3-(2-ethylsulfanylethyl)-N-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine.
| Compound Name | 3-(2-ethylsulfanylethyl)-N-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 14836835 |
| Molecular Formula | C13H15F3N2OS2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 3-(2-ethylsulfanylethyl)-N-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine |
| SMILES | CCSCCn1/c(=N/C)sc2cc(OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C13H15F3N2OS2/c1-3-20-7-6-18-10-5-4-9(19-13(14,15)16)8-11(10)21-12(18)17-2/h4-5,8H,3,6-7H2,1-2H3/b17-12- |
| InChIKey | OTWYSOVPVHLQRC-ATVHPVEESA-N |
| XLogP | 3.88 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|