C13H10F3N3O5S — CID 3076376
3-[2-imino-6-(trifluoromethoxy)-1,3-benzothiazol-3-yl]propanenitrile;oxalic acid (PubChem CID 3076376) has the molecular formula C13H10F3N3O5S and a molecular weight of 377.30 g/mol. Its IUPAC name is 3-[2-imino-6-(trifluoromethoxy)-1,3-benzothiazol-3-yl]propanenitrile;oxalic acid.
| Compound Name | 3-[2-imino-6-(trifluoromethoxy)-1,3-benzothiazol-3-yl]propanenitrile;oxalic acid |
|---|---|
| PubChem CID | 3076376 |
| Molecular Formula | C13H10F3N3O5S |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 3-[2-imino-6-(trifluoromethoxy)-1,3-benzothiazol-3-yl]propanenitrile;oxalic acid |
| SMILES | O=C(O)C(=O)O.[H]/N=c1\sc2cc(OC(F)(F)F)ccc2n1CCC#N |
| InChI | InChI=1S/C11H8F3N3OS.C2H2O4/c12-11(13,14)18-7-2-3-8-9(6-7)19-10(16)17(8)5-1-4-15;3-1(4)2(5)6/h2-3,6,16H,1,5H2;(H,3,4)(H,5,6)/b16-10-; |
| InChIKey | QPPHJRXMBBZAGT-HYMQDMCPSA-N |
| XLogP | 2.15 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|