About 3-[2-(4-phenylpiperazin-1-yl)ethyl]-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine
3-[2-(4-phenylpiperazin-1-yl)ethyl]-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine (PubChem CID 10550153) has the molecular formula C20H21F3N4OS
and a molecular weight of 422.48 g/mol. Its IUPAC name is 3-[2-(4-phenylpiperazin-1-yl)ethyl]-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine.
Molecular Properties
| Compound Name | 3-[2-(4-phenylpiperazin-1-yl)ethyl]-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine |
| PubChem CID | 10550153 |
| Molecular Formula | C20H21F3N4OS |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 3-[2-(4-phenylpiperazin-1-yl)ethyl]-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine |
| SMILES | [H]/N=c1\sc2cc(OC(F)(F)F)ccc2n1CCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H21F3N4OS/c21-20(22,23)28-16-6-7-17-18(14-16)29-19(24)27(17)13-10-25-8-11-26(12-9-25)15-4-2-1-3-5-15/h1-7,14,24H,8-13H2/b24-19- |
| InChIKey | ABHUMJXSVVFEPJ-CLCOLTQESA-N |
| XLogP | 3.90 |
| TPSA | 44.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[2-(4-phenylpiperazin-1-yl)ethyl]-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(4-phenylpiperazin-1-yl)ethyl]-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine?
The IUPAC name of 3-[2-(4-phenylpiperazin-1-yl)ethyl]-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine (CID 10550153) is 3-[2-(4-phenylpiperazin-1-yl)ethyl]-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine.
What is the SMILES notation for 3-[2-(4-phenylpiperazin-1-yl)ethyl]-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine?
The canonical SMILES for 3-[2-(4-phenylpiperazin-1-yl)ethyl]-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine is [H]/N=c1\sc2cc(OC(F)(F)F)ccc2n1CCN1CCN(c2ccccc2)CC1.
What is the InChIKey of 3-[2-(4-phenylpiperazin-1-yl)ethyl]-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine?
The InChIKey is ABHUMJXSVVFEPJ-CLCOLTQESA-N. The full InChI is InChI=1S/C20H21F3N4OS/c21-20(22,23)28-16-6-7-17-18(14-16)29-19(24)27(17)13-10-25-8-11-26(12-9-25)15-4-2-1-3-5-15/h1-7,14,24H,8-13H2/b24-19-.
What are the key properties of 3-[2-(4-phenylpiperazin-1-yl)ethyl]-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine?
3-[2-(4-phenylpiperazin-1-yl)ethyl]-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine has a molecular weight of 422.48 g/mol, XLogP of 3.90, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(4-phenylpiperazin-1-yl)ethyl]-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine is sourced from PubChem (CID 10550153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).