C8H6ClF3N2OS — CID 6419992
6-(trifluoromethoxy)-1,3-benzothiazol-2-amine;hydrochloride (PubChem CID 6419992) has the molecular formula C8H6ClF3N2OS and a molecular weight of 270.66 g/mol. Its IUPAC name is 6-(trifluoromethoxy)-1,3-benzothiazol-2-amine;hydrochloride.
| Compound Name | 6-(trifluoromethoxy)-1,3-benzothiazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 6419992 |
| Molecular Formula | C8H6ClF3N2OS |
| Molecular Weight | 270.66 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | 6-(trifluoromethoxy)-1,3-benzothiazol-2-amine;hydrochloride |
| SMILES | Cl.Nc1nc2ccc(OC(F)(F)F)cc2s1 |
| InChI | InChI=1S/C8H5F3N2OS.ClH/c9-8(10,11)14-4-1-2-5-6(3-4)15-7(12)13-5;/h1-3H,(H2,12,13);1H |
| InChIKey | QEAOELIJQRYJJS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.66 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |