About 4-oxo-1H-quinoline-2-carboxylic acid;6-(trifluoromethoxy)-1,3-benzothiazol-2-amine
4-oxo-1H-quinoline-2-carboxylic acid;6-(trifluoromethoxy)-1,3-benzothiazol-2-amine (PubChem CID 87187000) has the molecular formula C18H12F3N3O4S
and a molecular weight of 423.37 g/mol. Its IUPAC name is 4-oxo-1H-quinoline-2-carboxylic acid;6-(trifluoromethoxy)-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | 4-oxo-1H-quinoline-2-carboxylic acid;6-(trifluoromethoxy)-1,3-benzothiazol-2-amine |
| PubChem CID | 87187000 |
| Molecular Formula | C18H12F3N3O4S |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | 4-oxo-1H-quinoline-2-carboxylic acid;6-(trifluoromethoxy)-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2ccc(OC(F)(F)F)cc2s1.O=C(O)c1cc(=O)c2ccccc2[nH]1 |
| InChI | InChI=1S/C10H7NO3.C8H5F3N2OS/c12-9-5-8(10(13)14)11-7-4-2-1-3-6(7)9;9-8(10,11)14-4-1-2-5-6(3-4)15-7(12)13-5/h1-5H,(H,11,12)(H,13,14);1-3H,(H2,12,13) |
| InChIKey | MAQNFFMMBQWMCF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-oxo-1H-quinoline-2-carboxylic acid;6-(trifluoromethoxy)-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-1H-quinoline-2-carboxylic acid;6-(trifluoromethoxy)-1,3-benzothiazol-2-amine?
The IUPAC name of 4-oxo-1H-quinoline-2-carboxylic acid;6-(trifluoromethoxy)-1,3-benzothiazol-2-amine (CID 87187000) is 4-oxo-1H-quinoline-2-carboxylic acid;6-(trifluoromethoxy)-1,3-benzothiazol-2-amine.
What is the SMILES notation for 4-oxo-1H-quinoline-2-carboxylic acid;6-(trifluoromethoxy)-1,3-benzothiazol-2-amine?
The canonical SMILES for 4-oxo-1H-quinoline-2-carboxylic acid;6-(trifluoromethoxy)-1,3-benzothiazol-2-amine is Nc1nc2ccc(OC(F)(F)F)cc2s1.O=C(O)c1cc(=O)c2ccccc2[nH]1.
What is the InChIKey of 4-oxo-1H-quinoline-2-carboxylic acid;6-(trifluoromethoxy)-1,3-benzothiazol-2-amine?
The InChIKey is MAQNFFMMBQWMCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO3.C8H5F3N2OS/c12-9-5-8(10(13)14)11-7-4-2-1-3-6(7)9;9-8(10,11)14-4-1-2-5-6(3-4)15-7(12)13-5/h1-5H,(H,11,12)(H,13,14);1-3H,(H2,12,13).
What are the key properties of 4-oxo-1H-quinoline-2-carboxylic acid;6-(trifluoromethoxy)-1,3-benzothiazol-2-amine?
4-oxo-1H-quinoline-2-carboxylic acid;6-(trifluoromethoxy)-1,3-benzothiazol-2-amine has a molecular weight of 423.37 g/mol, XLogP of 4.00, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-1H-quinoline-2-carboxylic acid;6-(trifluoromethoxy)-1,3-benzothiazol-2-amine is sourced from PubChem (CID 87187000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).