C15H11FN2O2S — CID 750191
4-fluoro-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 750191) has the molecular formula C15H11FN2O2S and a molecular weight of 302.33 g/mol. Its IUPAC name is 4-fluoro-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-fluoro-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 750191 |
| Molecular Formula | C15H11FN2O2S |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 4-fluoro-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | COc1ccc2nc(NC(=O)c3ccc(F)cc3)sc2c1 |
| InChI | InChI=1S/C15H11FN2O2S/c1-20-11-6-7-12-13(8-11)21-15(17-12)18-14(19)9-2-4-10(16)5-3-9/h2-8H,1H3,(H,17,18,19) |
| InChIKey | LAYNIDVNMKRZNL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |