About 6-chloro-3-propyl-1,3-benzothiazol-3-ium-2-amine
6-chloro-3-propyl-1,3-benzothiazol-3-ium-2-amine (PubChem CID 52904081) has the molecular formula C10H12ClN2S+
and a molecular weight of 227.74 g/mol. Its IUPAC name is 6-chloro-3-propyl-1,3-benzothiazol-3-ium-2-amine.
Molecular Properties
| Compound Name | 6-chloro-3-propyl-1,3-benzothiazol-3-ium-2-amine |
| PubChem CID | 52904081 |
| Molecular Formula | C10H12ClN2S+ |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 6-chloro-3-propyl-1,3-benzothiazol-3-ium-2-amine |
| SMILES | CCC[n+]1c(N)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C10H11ClN2S/c1-2-5-13-8-4-3-7(11)6-9(8)14-10(13)12/h3-4,6,12H,2,5H2,1H3/p+1 |
| InChIKey | IIILYRLNXCTRHJ-UHFFFAOYSA-O |
| XLogP | 2.83 |
| TPSA | 29.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3-propyl-1,3-benzothiazol-3-ium-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-propyl-1,3-benzothiazol-3-ium-2-amine?
The IUPAC name of 6-chloro-3-propyl-1,3-benzothiazol-3-ium-2-amine (CID 52904081) is 6-chloro-3-propyl-1,3-benzothiazol-3-ium-2-amine.
What is the SMILES notation for 6-chloro-3-propyl-1,3-benzothiazol-3-ium-2-amine?
The canonical SMILES for 6-chloro-3-propyl-1,3-benzothiazol-3-ium-2-amine is CCC[n+]1c(N)sc2cc(Cl)ccc21.
What is the InChIKey of 6-chloro-3-propyl-1,3-benzothiazol-3-ium-2-amine?
The InChIKey is IIILYRLNXCTRHJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H11ClN2S/c1-2-5-13-8-4-3-7(11)6-9(8)14-10(13)12/h3-4,6,12H,2,5H2,1H3/p+1.
What are the key properties of 6-chloro-3-propyl-1,3-benzothiazol-3-ium-2-amine?
6-chloro-3-propyl-1,3-benzothiazol-3-ium-2-amine has a molecular weight of 227.74 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-propyl-1,3-benzothiazol-3-ium-2-amine is sourced from PubChem (CID 52904081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).