C27H32ClN2OS+ — CID 59006009
N-[(1E,3E)-4-(6-chloro-3-octyl-1,3-benzothiazol-3-ium-2-yl)buta-1,3-dienyl]-N-phenylacetamide (PubChem CID 59006009) has the molecular formula C27H32ClN2OS+ and a molecular weight of 468.09 g/mol. Its IUPAC name is N-[(1E,3E)-4-(6-chloro-3-octyl-1,3-benzothiazol-3-ium-2-yl)buta-1,3-dienyl]-N-phenylacetamide.
| Compound Name | N-[(1E,3E)-4-(6-chloro-3-octyl-1,3-benzothiazol-3-ium-2-yl)buta-1,3-dienyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 59006009 |
| Molecular Formula | C27H32ClN2OS+ |
| Molecular Weight | 468.09 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | N-[(1E,3E)-4-(6-chloro-3-octyl-1,3-benzothiazol-3-ium-2-yl)buta-1,3-dienyl]-N-phenylacetamide |
| SMILES | CCCCCCCC[n+]1c(/C=C/C=C/N(C(C)=O)c2ccccc2)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C27H32ClN2OS/c1-3-4-5-6-7-12-20-30-25-18-17-23(28)21-26(25)32-27(30)16-11-13-19-29(22(2)31)24-14-9-8-10-15-24/h8-11,13-19,21H,3-7,12,20H2,1-2H3/q+1 |
| InChIKey | IIHMFZINPMXURP-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 24.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.09 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|