C24H28NO2S+ — CID 5142889
heptyl 2-[2-(2-phenylethenyl)-1,3-benzothiazol-3-ium-3-yl]acetate (PubChem CID 5142889) has the molecular formula C24H28NO2S+ and a molecular weight of 394.56 g/mol. Its IUPAC name is heptyl 2-[2-(2-phenylethenyl)-1,3-benzothiazol-3-ium-3-yl]acetate.
| Compound Name | heptyl 2-[2-(2-phenylethenyl)-1,3-benzothiazol-3-ium-3-yl]acetate |
|---|---|
| PubChem CID | 5142889 |
| Molecular Formula | C24H28NO2S+ |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | heptyl 2-[2-(2-phenylethenyl)-1,3-benzothiazol-3-ium-3-yl]acetate |
| SMILES | CCCCCCCOC(=O)C[n+]1c(C=Cc2ccccc2)sc2ccccc21 |
| InChI | InChI=1S/C24H28NO2S/c1-2-3-4-5-11-18-27-24(26)19-25-21-14-9-10-15-22(21)28-23(25)17-16-20-12-7-6-8-13-20/h6-10,12-17H,2-5,11,18-19H2,1H3/q+1 |
| InChIKey | NQVLXVRKHITRSM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|