C21H23N2OS+ — CID 20695756
N-[(E)-2-(3-butyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N-phenylacetamide (PubChem CID 20695756) has the molecular formula C21H23N2OS+ and a molecular weight of 351.50 g/mol. Its IUPAC name is N-[(E)-2-(3-butyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N-phenylacetamide.
| Compound Name | N-[(E)-2-(3-butyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 20695756 |
| Molecular Formula | C21H23N2OS+ |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | N-[(E)-2-(3-butyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N-phenylacetamide |
| SMILES | CCCC[n+]1c(/C=C/N(C(C)=O)c2ccccc2)sc2ccccc21 |
| InChI | InChI=1S/C21H23N2OS/c1-3-4-15-23-19-12-8-9-13-20(19)25-21(23)14-16-22(17(2)24)18-10-6-5-7-11-18/h5-14,16H,3-4,15H2,1-2H3/q+1 |
| InChIKey | RELNVQHLMBCYPM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 24.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|