C22H23IN2O3S — CID 45379442
3-[2-[(E)-2-(N-acetylanilino)ethenyl]-1,3-benzothiazol-3-ium-3-yl]propyl acetate iodide (PubChem CID 45379442) has the molecular formula C22H23IN2O3S and a molecular weight of 522.41 g/mol. Its IUPAC name is 3-[2-[(E)-2-(N-acetylanilino)ethenyl]-1,3-benzothiazol-3-ium-3-yl]propyl acetate iodide.
| Compound Name | 3-[2-[(E)-2-(N-acetylanilino)ethenyl]-1,3-benzothiazol-3-ium-3-yl]propyl acetate iodide |
|---|---|
| PubChem CID | 45379442 |
| Molecular Formula | C22H23IN2O3S |
| Molecular Weight | 522.41 g/mol |
| Exact Mass | 522.05 |
| IUPAC Name | 3-[2-[(E)-2-(N-acetylanilino)ethenyl]-1,3-benzothiazol-3-ium-3-yl]propyl acetate iodide |
| SMILES | CC(=O)OCCC[n+]1c(/C=C/N(C(C)=O)c2ccccc2)sc2ccccc21.[I-] |
| InChI | InChI=1S/C22H23N2O3S.HI/c1-17(25)23(19-9-4-3-5-10-19)15-13-22-24(14-8-16-27-18(2)26)20-11-6-7-12-21(20)28-22;/h3-7,9-13,15H,8,14,16H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | HRCCETUDWVNDEF-UHFFFAOYSA-M |
| XLogP | 1.17 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.41 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|