C19H23N4S+ — CID 23278964
N-[(E)-(3-butyl-1,3-benzothiazol-3-ium-2-yl)diazenyl]-N-ethylaniline (PubChem CID 23278964) has the molecular formula C19H23N4S+ and a molecular weight of 339.49 g/mol. Its IUPAC name is N-[(E)-(3-butyl-1,3-benzothiazol-3-ium-2-yl)diazenyl]-N-ethylaniline.
| Compound Name | N-[(E)-(3-butyl-1,3-benzothiazol-3-ium-2-yl)diazenyl]-N-ethylaniline |
|---|---|
| PubChem CID | 23278964 |
| Molecular Formula | C19H23N4S+ |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-[(E)-(3-butyl-1,3-benzothiazol-3-ium-2-yl)diazenyl]-N-ethylaniline |
| SMILES | CCCC[n+]1c(/N=N/N(CC)c2ccccc2)sc2ccccc21 |
| InChI | InChI=1S/C19H23N4S/c1-3-5-15-22-17-13-9-10-14-18(17)24-19(22)20-21-23(4-2)16-11-7-6-8-12-16/h6-14H,3-5,15H2,1-2H3/q+1 |
| InChIKey | JBCAMLXSXFVWPK-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|