C27H24BF4N2PS — CID 12519188
(3-ethyl-1,3-benzothiazol-3-ium-2-yl)imino-triphenyl-lambda5-phosphane tetrafluoroborate (PubChem CID 12519188) has the molecular formula C27H24BF4N2PS and a molecular weight of 526.35 g/mol. Its IUPAC name is (3-ethyl-1,3-benzothiazol-3-ium-2-yl)imino-triphenyl-lambda5-phosphane tetrafluoroborate.
| Compound Name | (3-ethyl-1,3-benzothiazol-3-ium-2-yl)imino-triphenyl-lambda5-phosphane tetrafluoroborate |
|---|---|
| PubChem CID | 12519188 |
| Molecular Formula | C27H24BF4N2PS |
| Molecular Weight | 526.35 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | (3-ethyl-1,3-benzothiazol-3-ium-2-yl)imino-triphenyl-lambda5-phosphane tetrafluoroborate |
| SMILES | CC[n+]1c(N=P(c2ccccc2)(c2ccccc2)c2ccccc2)sc2ccccc21.F[B-](F)(F)F |
| InChI | InChI=1S/C27H24N2PS.BF4/c1-2-29-25-20-12-13-21-26(25)31-27(29)28-30(22-14-6-3-7-15-22,23-16-8-4-9-17-23)24-18-10-5-11-19-24;2-1(3,4)5/h3-21H,2H2,1H3;/q+1;-1 |
| InChIKey | NMKFAPZGKQVIPW-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 16.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.35 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|