C10H13N2S+ — CID 52904080
3-propyl-1,3-benzothiazol-3-ium-2-amine (PubChem CID 52904080) has the molecular formula C10H13N2S+ and a molecular weight of 193.30 g/mol. Its IUPAC name is 3-propyl-1,3-benzothiazol-3-ium-2-amine.
| Compound Name | 3-propyl-1,3-benzothiazol-3-ium-2-amine |
|---|---|
| PubChem CID | 52904080 |
| Molecular Formula | C10H13N2S+ |
| Molecular Weight | 193.30 g/mol |
| Exact Mass | 193.08 |
| IUPAC Name | 3-propyl-1,3-benzothiazol-3-ium-2-amine |
| SMILES | CCC[n+]1c(N)sc2ccccc21 |
| InChI | InChI=1S/C10H12N2S/c1-2-7-12-8-5-3-4-6-9(8)13-10(12)11/h3-6,11H,2,7H2,1H3/p+1 |
| InChIKey | MQHVXSGCJWZXOK-UHFFFAOYSA-O |
| XLogP | 2.18 |
| TPSA | 29.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|