C23H34N4S2Si2+2 — CID 163408719
3-[[3-[(2-amino-1,3-benzothiazol-3-ium-3-yl)methyl-dimethylsilyl]propyl-dimethylsilyl]methyl]-1,3-benzothiazol-3-ium-2-amine (PubChem CID 163408719) has the molecular formula C23H34N4S2Si2+2 and a molecular weight of 486.86 g/mol. Its IUPAC name is 3-[[3-[(2-amino-1,3-benzothiazol-3-ium-3-yl)methyl-dimethylsilyl]propyl-dimethylsilyl]methyl]-1,3-benzothiazol-3-ium-2-amine.
| Compound Name | 3-[[3-[(2-amino-1,3-benzothiazol-3-ium-3-yl)methyl-dimethylsilyl]propyl-dimethylsilyl]methyl]-1,3-benzothiazol-3-ium-2-amine |
|---|---|
| PubChem CID | 163408719 |
| Molecular Formula | C23H34N4S2Si2+2 |
| Molecular Weight | 486.86 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 3-[[3-[(2-amino-1,3-benzothiazol-3-ium-3-yl)methyl-dimethylsilyl]propyl-dimethylsilyl]methyl]-1,3-benzothiazol-3-ium-2-amine |
| SMILES | C[Si](C)(CCC[Si](C)(C)C[n+]1c(N)sc2ccccc21)C[n+]1c(N)sc2ccccc21 |
| InChI | InChI=1S/C23H32N4S2Si2/c1-30(2,16-26-18-10-5-7-12-20(18)28-22(26)24)14-9-15-31(3,4)17-27-19-11-6-8-13-21(19)29-23(27)25/h5-8,10-13,24-25H,9,14-17H2,1-4H3/p+2 |
| InChIKey | AGKLMENQIYTOPI-UHFFFAOYSA-P |
| XLogP | 5.44 |
| TPSA | 59.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.86 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|