C28H22N6S4+2 — CID 59858272
phenyl-[3-[[(2-phenyldiazenyl-1,3-benzothiazol-3-ium-3-yl)methyldisulfanyl]methyl]-1,3-benzothiazol-3-ium-2-yl]diazene (PubChem CID 59858272) has the molecular formula C28H22N6S4+2 and a molecular weight of 570.79 g/mol. Its IUPAC name is phenyl-[3-[[(2-phenyldiazenyl-1,3-benzothiazol-3-ium-3-yl)methyldisulfanyl]methyl]-1,3-benzothiazol-3-ium-2-yl]diazene.
| Compound Name | phenyl-[3-[[(2-phenyldiazenyl-1,3-benzothiazol-3-ium-3-yl)methyldisulfanyl]methyl]-1,3-benzothiazol-3-ium-2-yl]diazene |
|---|---|
| PubChem CID | 59858272 |
| Molecular Formula | C28H22N6S4+2 |
| Molecular Weight | 570.79 g/mol |
| Exact Mass | 570.08 |
| IUPAC Name | phenyl-[3-[[(2-phenyldiazenyl-1,3-benzothiazol-3-ium-3-yl)methyldisulfanyl]methyl]-1,3-benzothiazol-3-ium-2-yl]diazene |
| SMILES | c1ccc(/N=N/c2sc3ccccc3[n+]2CSSC[n+]2c(/N=N/c3ccccc3)sc3ccccc32)cc1 |
| InChI | InChI=1S/C28H22N6S4/c1-3-11-21(12-4-1)29-31-27-33(23-15-7-9-17-25(23)37-27)19-35-36-20-34-24-16-8-10-18-26(24)38-28(34)32-30-22-13-5-2-6-14-22/h1-18H,19-20H2/q+2 |
| InChIKey | ZZGPJJXTBBXJAX-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.79 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|