C17H18NS+ — CID 87086508
3-benzyl-2-propan-2-yl-1,3-benzothiazol-3-ium (PubChem CID 87086508) has the molecular formula C17H18NS+ and a molecular weight of 268.41 g/mol. Its IUPAC name is 3-benzyl-2-propan-2-yl-1,3-benzothiazol-3-ium.
| Compound Name | 3-benzyl-2-propan-2-yl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 87086508 |
| Molecular Formula | C17H18NS+ |
| Molecular Weight | 268.41 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 3-benzyl-2-propan-2-yl-1,3-benzothiazol-3-ium |
| SMILES | CC(C)c1sc2ccccc2[n+]1Cc1ccccc1 |
| InChI | InChI=1S/C17H18NS/c1-13(2)17-18(12-14-8-4-3-5-9-14)15-10-6-7-11-16(15)19-17/h3-11,13H,12H2,1-2H3/q+1 |
| InChIKey | QYFDVFMEXPCACQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|