C19H20NOS+ — CID 10363024
(3-benzyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-phenyl(113C)methanol (PubChem CID 10363024) has the molecular formula C19H20NOS+ and a molecular weight of 311.43 g/mol. Its IUPAC name is (3-benzyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-phenyl(113C)methanol.
| Compound Name | (3-benzyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-phenyl(113C)methanol |
|---|---|
| PubChem CID | 10363024 |
| Molecular Formula | C19H20NOS+ |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (3-benzyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-phenyl(113C)methanol |
| SMILES | Cc1sc([13CH](O)c2ccccc2)[n+](Cc2ccccc2)c1C |
| InChI | InChI=1S/C19H20NOS/c1-14-15(2)22-19(18(21)17-11-7-4-8-12-17)20(14)13-16-9-5-3-6-10-16/h3-12,18,21H,13H2,1-2H3/q+1/i18+1 |
| InChIKey | SXDYLABSZPHOPY-CPZJZEHKSA-N |
| XLogP | 3.78 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|