C13H16NOS+ — CID 54306339
phenyl-(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)methanol (PubChem CID 54306339) has the molecular formula C13H16NOS+ and a molecular weight of 234.34 g/mol. Its IUPAC name is phenyl-(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)methanol.
| Compound Name | phenyl-(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)methanol |
|---|---|
| PubChem CID | 54306339 |
| Molecular Formula | C13H16NOS+ |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | phenyl-(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)methanol |
| SMILES | Cc1sc(C(O)c2ccccc2)[n+](C)c1C |
| InChI | InChI=1S/C13H16NOS/c1-9-10(2)16-13(14(9)3)12(15)11-7-5-4-6-8-11/h4-8,12,15H,1-3H3/q+1 |
| InChIKey | SHUCZHRTERFVSD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|